C13H23NO — CID 142103581
1-butoxy-3,5-dimethylbenzene;methanamine (PubChem CID 142103581) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-butoxy-3,5-dimethylbenzene;methanamine.
| Compound Name | 1-butoxy-3,5-dimethylbenzene;methanamine |
|---|---|
| PubChem CID | 142103581 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-butoxy-3,5-dimethylbenzene;methanamine |
| SMILES | CCCCOc1cc(C)cc(C)c1.CN |
| InChI | InChI=1S/C12H18O.CH5N/c1-4-5-6-13-12-8-10(2)7-11(3)9-12;1-2/h7-9H,4-6H2,1-3H3;2H2,1H3 |
| InChIKey | WUBKBZVMXNHGEK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|