C12H18OS — CID 91655340
4-butoxy-2,6-dimethylbenzenethiol (PubChem CID 91655340) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 4-butoxy-2,6-dimethylbenzenethiol.
| Compound Name | 4-butoxy-2,6-dimethylbenzenethiol |
|---|---|
| PubChem CID | 91655340 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 4-butoxy-2,6-dimethylbenzenethiol |
| SMILES | CCCCOc1cc(C)c(S)c(C)c1 |
| InChI | InChI=1S/C12H18OS/c1-4-5-6-13-11-7-9(2)12(14)10(3)8-11/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | HRCBZJNLQRUZNY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|