C15H26N2O2S — CID 142000955
4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine (PubChem CID 142000955) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine.
| Compound Name | 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142000955 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.Cc1cc(OCCCC=O)cc(C)c1S |
| InChI | InChI=1S/C12H16O2S.C3H10N2/c1-9-7-11(8-10(2)12(9)15)14-6-4-3-5-13;1-5-3-2-4/h5,7-8,15H,3-4,6H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | MSQWOVBVYUMQHO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|