About 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine
4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine (PubChem CID 142000955) has the molecular formula C15H26N2O2S
and a molecular weight of 298.45 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine |
| PubChem CID | 142000955 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.Cc1cc(OCCCC=O)cc(C)c1S |
| InChI | InChI=1S/C12H16O2S.C3H10N2/c1-9-7-11(8-10(2)12(9)15)14-6-4-3-5-13;1-5-3-2-4/h5,7-8,15H,3-4,6H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | MSQWOVBVYUMQHO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine?
The IUPAC name of 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine (CID 142000955) is 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine.
What is the SMILES notation for 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine?
The canonical SMILES for 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine is CNCCN.Cc1cc(OCCCC=O)cc(C)c1S.
What is the InChIKey of 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine?
The InChIKey is MSQWOVBVYUMQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2S.C3H10N2/c1-9-7-11(8-10(2)12(9)15)14-6-4-3-5-13;1-5-3-2-4/h5,7-8,15H,3-4,6H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine?
4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine has a molecular weight of 298.45 g/mol, XLogP of 2.11, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-4-sulfanylphenoxy)butanal;N'-methylethane-1,2-diamine is sourced from PubChem (CID 142000955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).