C17H28N2O5 — CID 2922383
N'-[3-(3-methyl-4-propan-2-ylphenoxy)propyl]ethane-1,2-diamine;oxalic acid (PubChem CID 2922383) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is N'-[3-(3-methyl-4-propan-2-ylphenoxy)propyl]ethane-1,2-diamine;oxalic acid.
| Compound Name | N'-[3-(3-methyl-4-propan-2-ylphenoxy)propyl]ethane-1,2-diamine;oxalic acid |
|---|---|
| PubChem CID | 2922383 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | N'-[3-(3-methyl-4-propan-2-ylphenoxy)propyl]ethane-1,2-diamine;oxalic acid |
| SMILES | Cc1cc(OCCCNCCN)ccc1C(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H26N2O.C2H2O4/c1-12(2)15-6-5-14(11-13(15)3)18-10-4-8-17-9-7-16;3-1(4)2(5)6/h5-6,11-12,17H,4,7-10,16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | TUUYEEZFIVNPIE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|