C18H29NO3 — CID 122099927
(2S,3S)-3-methyl-2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]pentanoic acid (PubChem CID 122099927) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 122099927 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (2S,3S)-3-methyl-2-[2-(3-methyl-4-propan-2-ylphenoxy)ethylamino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCCOc1ccc(C(C)C)c(C)c1)C(=O)O |
| InChI | InChI=1S/C18H29NO3/c1-6-13(4)17(18(20)21)19-9-10-22-15-7-8-16(12(2)3)14(5)11-15/h7-8,11-13,17,19H,6,9-10H2,1-5H3,(H,20,21)/t13-,17-/m0/s1 |
| InChIKey | HTZXUZKOCTXJDD-GUYCJALGSA-N |
| XLogP | 3.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|