C22H32N2O5 — CID 155584061
acetylene;pentanedial;N,N',2-trimethyl-4-(5-oxopentoxy)benzohydrazide (PubChem CID 155584061) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is acetylene;pentanedial;N,N',2-trimethyl-4-(5-oxopentoxy)benzohydrazide.
| Compound Name | acetylene;pentanedial;N,N',2-trimethyl-4-(5-oxopentoxy)benzohydrazide |
|---|---|
| PubChem CID | 155584061 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | acetylene;pentanedial;N,N',2-trimethyl-4-(5-oxopentoxy)benzohydrazide |
| SMILES | C#C.CNN(C)C(=O)c1ccc(OCCCCC=O)cc1C.O=CCCCC=O |
| InChI | InChI=1S/C15H22N2O3.C5H8O2.C2H2/c1-12-11-13(20-10-6-4-5-9-18)7-8-14(12)15(19)17(3)16-2;6-4-2-1-3-5-7;1-2/h7-9,11,16H,4-6,10H2,1-3H3;4-5H,1-3H2;1-2H |
| InChIKey | DRJFNBVFKKSGPN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|