C24H36N2O7 — CID 142365374
2-formyl-4-[5-(4-hydroxybutoxy)pentoxy]-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide (PubChem CID 142365374) has the molecular formula C24H36N2O7 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-formyl-4-[5-(4-hydroxybutoxy)pentoxy]-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | 2-formyl-4-[5-(4-hydroxybutoxy)pentoxy]-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 142365374 |
| Molecular Formula | C24H36N2O7 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-formyl-4-[5-(4-hydroxybutoxy)pentoxy]-N-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C)C(=O)c1ccc(OCCCCCOCCCCO)cc1C=O |
| InChI | InChI=1S/C24H36N2O7/c1-25-23(30)22(9-8-13-28)26(2)24(31)21-11-10-20(17-19(21)18-29)33-16-6-3-5-14-32-15-7-4-12-27/h10-11,13,17-18,22,27H,3-9,12,14-16H2,1-2H3,(H,25,30) |
| InChIKey | ADUNLKPUUICHRL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|