C26H34N4O5 — CID 155583753
5-[6-(6-amino-3-pyridinyl)hexoxy]-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide (PubChem CID 155583753) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 5-[6-(6-amino-3-pyridinyl)hexoxy]-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide.
| Compound Name | 5-[6-(6-amino-3-pyridinyl)hexoxy]-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 155583753 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 5-[6-(6-amino-3-pyridinyl)hexoxy]-N-formyl-2-methyl-N-[1-(methylamino)-1,5-dioxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CCC=O)N(C=O)C(=O)c1cc(OCCCCCCc2ccc(N)nc2)ccc1C |
| InChI | InChI=1S/C26H34N4O5/c1-19-10-12-21(35-15-6-4-3-5-8-20-11-13-24(27)29-17-20)16-22(19)26(34)30(18-32)23(9-7-14-31)25(33)28-2/h10-14,16-18,23H,3-9,15H2,1-2H3,(H2,27,29)(H,28,33) |
| InChIKey | OYBYBHZASVVIQR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|