C34H50N2O8 — CID 156713200
tert-butyl 4-[5-(4-formyl-3-methylphenoxy)pentoxy]benzoate;ethane;2-[formyl(methyl)amino]-N-methyl-5-oxopentanamide (PubChem CID 156713200) has the molecular formula C34H50N2O8 and a molecular weight of 614.78 g/mol. Its IUPAC name is tert-butyl 4-[5-(4-formyl-3-methylphenoxy)pentoxy]benzoate;ethane;2-[formyl(methyl)amino]-N-methyl-5-oxopentanamide.
| Compound Name | tert-butyl 4-[5-(4-formyl-3-methylphenoxy)pentoxy]benzoate;ethane;2-[formyl(methyl)amino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 156713200 |
| Molecular Formula | C34H50N2O8 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | tert-butyl 4-[5-(4-formyl-3-methylphenoxy)pentoxy]benzoate;ethane;2-[formyl(methyl)amino]-N-methyl-5-oxopentanamide |
| SMILES | CC.CNC(=O)C(CCC=O)N(C)C=O.Cc1cc(OCCCCCOc2ccc(C(=O)OC(C)(C)C)cc2)ccc1C=O |
| InChI | InChI=1S/C24H30O5.C8H14N2O3.C2H6/c1-18-16-22(13-10-20(18)17-25)28-15-7-5-6-14-27-21-11-8-19(9-12-21)23(26)29-24(2,3)4;1-9-8(13)7(4-3-5-11)10(2)6-12;1-2/h8-13,16-17H,5-7,14-15H2,1-4H3;5-7H,3-4H2,1-2H3,(H,9,13);1-2H3 |
| InChIKey | XJELVHONSCVVFI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|