About methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate
methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate (PubChem CID 171810853) has the molecular formula C22H28O6
and a molecular weight of 388.46 g/mol. Its IUPAC name is methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate.
Molecular Properties
| Compound Name | methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate |
| PubChem CID | 171810853 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate |
| SMILES | COC.COC(=O)c1cc(OCCCOc2ccc(C=O)c(C)c2)ccc1C |
| InChI | InChI=1S/C20H22O5.C2H6O/c1-14-5-7-18(12-19(14)20(22)23-3)25-10-4-9-24-17-8-6-16(13-21)15(2)11-17;1-3-2/h5-8,11-13H,4,9-10H2,1-3H3;1-2H3 |
| InChIKey | XIJQZKDBHPIVQA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate?
The IUPAC name of methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate (CID 171810853) is methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate.
What is the SMILES notation for methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate?
The canonical SMILES for methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate is COC.COC(=O)c1cc(OCCCOc2ccc(C=O)c(C)c2)ccc1C.
What is the InChIKey of methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate?
The InChIKey is XIJQZKDBHPIVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O5.C2H6O/c1-14-5-7-18(12-19(14)20(22)23-3)25-10-4-9-24-17-8-6-16(13-21)15(2)11-17;1-3-2/h5-8,11-13H,4,9-10H2,1-3H3;1-2H3.
What are the key properties of methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate?
methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate has a molecular weight of 388.46 g/mol, XLogP of 4.01, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;methyl 5-[3-(4-formyl-3-methylphenoxy)propoxy]-2-methylbenzoate is sourced from PubChem (CID 171810853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).