C34H32O8 — CID 163401735
methyl formate;methyl 2-formyl-5-[4-[2-[4-(4-formyl-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]benzoate (PubChem CID 163401735) has the molecular formula C34H32O8 and a molecular weight of 568.62 g/mol. Its IUPAC name is methyl formate;methyl 2-formyl-5-[4-[2-[4-(4-formyl-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]benzoate.
| Compound Name | methyl formate;methyl 2-formyl-5-[4-[2-[4-(4-formyl-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]benzoate |
|---|---|
| PubChem CID | 163401735 |
| Molecular Formula | C34H32O8 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | methyl formate;methyl 2-formyl-5-[4-[2-[4-(4-formyl-3-methylphenoxy)phenyl]propan-2-yl]phenoxy]benzoate |
| SMILES | COC(=O)c1cc(Oc2ccc(C(C)(C)c3ccc(Oc4ccc(C=O)c(C)c4)cc3)cc2)ccc1C=O.COC=O |
| InChI | InChI=1S/C32H28O6.C2H4O2/c1-21-17-28(11-5-22(21)19-33)37-26-13-7-24(8-14-26)32(2,3)25-9-15-27(16-10-25)38-29-12-6-23(20-34)30(18-29)31(35)36-4;1-4-2-3/h5-20H,1-4H3;2H,1H3 |
| InChIKey | XOPKVKFGVYYKIT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|