C32H32O3 — CID 143099401
[4-[2-[4-(3,4-dimethylphenoxy)phenyl]propan-2-yl]phenyl] 3,4-dimethylbenzoate (PubChem CID 143099401) has the molecular formula C32H32O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-[2-[4-(3,4-dimethylphenoxy)phenyl]propan-2-yl]phenyl] 3,4-dimethylbenzoate.
| Compound Name | [4-[2-[4-(3,4-dimethylphenoxy)phenyl]propan-2-yl]phenyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 143099401 |
| Molecular Formula | C32H32O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [4-[2-[4-(3,4-dimethylphenoxy)phenyl]propan-2-yl]phenyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(Oc2ccc(C(C)(C)c3ccc(OC(=O)c4ccc(C)c(C)c4)cc3)cc2)cc1C |
| InChI | InChI=1S/C32H32O3/c1-21-7-9-25(19-23(21)3)31(33)35-29-17-12-27(13-18-29)32(5,6)26-10-15-28(16-11-26)34-30-14-8-22(2)24(4)20-30/h7-20H,1-6H3 |
| InChIKey | HLDRTJSRCUISFL-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|