C43H50O2 — CID 159619159
bis(3,4-dimethylphenyl)methanone;4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene (PubChem CID 159619159) has the molecular formula C43H50O2 and a molecular weight of 598.87 g/mol. Its IUPAC name is bis(3,4-dimethylphenyl)methanone;4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene.
| Compound Name | bis(3,4-dimethylphenyl)methanone;4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 159619159 |
| Molecular Formula | C43H50O2 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | bis(3,4-dimethylphenyl)methanone;4-(3,4-dimethylphenoxy)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene |
| SMILES | Cc1cc(C)c(C)cc1C.Cc1ccc(C(=O)c2ccc(C)c(C)c2)cc1C.Cc1ccc(Oc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C17H18O.C16H18O.C10H14/c1-11-5-7-15(9-13(11)3)17(18)16-8-6-12(2)14(4)10-16;1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16;1-7-5-9(3)10(4)6-8(7)2/h5-10H,1-4H3;5-10H,1-4H3;5-6H,1-4H3 |
| InChIKey | MNRCKZMQUMRWEZ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |