C25H24O4 — CID 22898067
1-O-methyl 3-O-[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate (PubChem CID 22898067) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-O-methyl 3-O-[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22898067 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-O-methyl 3-O-[4-[2-(4-methylphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cccc(C(=O)Oc2ccc(C(C)(C)c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C25H24O4/c1-17-8-10-20(11-9-17)25(2,3)21-12-14-22(15-13-21)29-24(27)19-7-5-6-18(16-19)23(26)28-4/h5-16H,1-4H3 |
| InChIKey | BKQUUTSYAJZYAX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|