C39H32O6 — CID 59591578
1-O-[4-[2-(4-methoxyphenyl)ethynyl]phenyl] 3-O-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate (PubChem CID 59591578) has the molecular formula C39H32O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is 1-O-[4-[2-(4-methoxyphenyl)ethynyl]phenyl] 3-O-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate.
| Compound Name | 1-O-[4-[2-(4-methoxyphenyl)ethynyl]phenyl] 3-O-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59591578 |
| Molecular Formula | C39H32O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 1-O-[4-[2-(4-methoxyphenyl)ethynyl]phenyl] 3-O-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl] benzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C#Cc2ccc(OC(=O)c3cccc(C(=O)Oc4ccc(C(C)(C)c5ccc(OC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C39H32O6/c1-39(2,31-14-22-34(43-4)23-15-31)32-16-24-36(25-17-32)45-38(41)30-7-5-6-29(26-30)37(40)44-35-20-12-28(13-21-35)9-8-27-10-18-33(42-3)19-11-27/h5-7,10-26H,1-4H3 |
| InChIKey | XJBRTLYWPQAORR-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|