About [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one
[3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one (PubChem CID 162200473) has the molecular formula C33H32O6
and a molecular weight of 524.61 g/mol. Its IUPAC name is [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one.
Molecular Properties
| Compound Name | [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one |
| PubChem CID | 162200473 |
| Molecular Formula | C33H32O6 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one |
| SMILES | CC(C)=O.Cc1ccc(C(C)(C)c2ccc(OC(=O)Oc3cccc(OC(=O)c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C30H26O5.C3H6O/c1-21-12-14-23(15-13-21)30(2,3)24-16-18-25(19-17-24)34-29(32)35-27-11-7-10-26(20-27)33-28(31)22-8-5-4-6-9-22;1-3(2)4/h4-20H,1-3H3;1-2H3 |
| InChIKey | ZRNAODFCJOEMSI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one?
The IUPAC name of [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one (CID 162200473) is [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one.
What is the SMILES notation for [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one?
The canonical SMILES for [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one is CC(C)=O.Cc1ccc(C(C)(C)c2ccc(OC(=O)Oc3cccc(OC(=O)c4ccccc4)c3)cc2)cc1.
What is the InChIKey of [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one?
The InChIKey is ZRNAODFCJOEMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26O5.C3H6O/c1-21-12-14-23(15-13-21)30(2,3)24-16-18-25(19-17-24)34-29(32)35-27-11-7-10-26(20-27)33-28(31)22-8-5-4-6-9-22;1-3(2)4/h4-20H,1-3H3;1-2H3.
What are the key properties of [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one?
[3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one has a molecular weight of 524.61 g/mol, XLogP of 7.71, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]carbonyloxyphenyl] benzoate;propan-2-one is sourced from PubChem (CID 162200473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).