C26H18O10 — CID 166171275
1-O-[4-(4-formyloxycarbonyl-3-methylbenzoyl)oxyphenyl] 3-O-methyl 4-formylbenzene-1,3-dicarboxylate (PubChem CID 166171275) has the molecular formula C26H18O10 and a molecular weight of 490.42 g/mol. Its IUPAC name is 1-O-[4-(4-formyloxycarbonyl-3-methylbenzoyl)oxyphenyl] 3-O-methyl 4-formylbenzene-1,3-dicarboxylate.
| Compound Name | 1-O-[4-(4-formyloxycarbonyl-3-methylbenzoyl)oxyphenyl] 3-O-methyl 4-formylbenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 166171275 |
| Molecular Formula | C26H18O10 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 1-O-[4-(4-formyloxycarbonyl-3-methylbenzoyl)oxyphenyl] 3-O-methyl 4-formylbenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)Oc2ccc(OC(=O)c3ccc(C(=O)OC=O)c(C)c3)cc2)ccc1C=O |
| InChI | InChI=1S/C26H18O10/c1-15-11-16(5-10-21(15)26(32)34-14-28)23(29)35-19-6-8-20(9-7-19)36-24(30)17-3-4-18(13-27)22(12-17)25(31)33-2/h3-14H,1-2H3 |
| InChIKey | KJLQJBJJODWGQA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|