About methyl 4-formyl-3-iodobenzoate
methyl 4-formyl-3-iodobenzoate (PubChem CID 131403378) has the molecular formula C9H7IO3
and a molecular weight of 290.06 g/mol. Its IUPAC name is methyl 4-formyl-3-iodobenzoate.
Molecular Properties
| Compound Name | methyl 4-formyl-3-iodobenzoate |
| PubChem CID | 131403378 |
| Molecular Formula | C9H7IO3 |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | methyl 4-formyl-3-iodobenzoate |
| SMILES | COC(=O)c1ccc(C=O)c(I)c1 |
| InChI | InChI=1S/C9H7IO3/c1-13-9(12)6-2-3-7(5-11)8(10)4-6/h2-5H,1H3 |
| InChIKey | ZWIQVHQRDVSURY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-formyl-3-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-formyl-3-iodobenzoate?
The IUPAC name of methyl 4-formyl-3-iodobenzoate (CID 131403378) is methyl 4-formyl-3-iodobenzoate.
What is the SMILES notation for methyl 4-formyl-3-iodobenzoate?
The canonical SMILES for methyl 4-formyl-3-iodobenzoate is COC(=O)c1ccc(C=O)c(I)c1.
What is the InChIKey of methyl 4-formyl-3-iodobenzoate?
The InChIKey is ZWIQVHQRDVSURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IO3/c1-13-9(12)6-2-3-7(5-11)8(10)4-6/h2-5H,1H3.
What are the key properties of methyl 4-formyl-3-iodobenzoate?
methyl 4-formyl-3-iodobenzoate has a molecular weight of 290.06 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-formyl-3-iodobenzoate is sourced from PubChem (CID 131403378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).