C12H10O6 — CID 145162990
dimethyl 3,6-diformylbenzene-1,2-dicarboxylate (PubChem CID 145162990) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is dimethyl 3,6-diformylbenzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,6-diformylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 145162990 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | dimethyl 3,6-diformylbenzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C=O)ccc(C=O)c1C(=O)OC |
| InChI | InChI=1S/C12H10O6/c1-17-11(15)9-7(5-13)3-4-8(6-14)10(9)12(16)18-2/h3-6H,1-2H3 |
| InChIKey | TUQLWCBPVYNDNK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|