About methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate
methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate (PubChem CID 82408639) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate |
| PubChem CID | 82408639 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C=O)cn(C)c1C |
| InChI | InChI=1S/C9H11NO3/c1-6-8(9(12)13-3)7(5-11)4-10(6)2/h4-5H,1-3H3 |
| InChIKey | MDBKATSYSVMKGM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate?
The IUPAC name of methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate (CID 82408639) is methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate.
What is the SMILES notation for methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate?
The canonical SMILES for methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate is COC(=O)c1c(C=O)cn(C)c1C.
What is the InChIKey of methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate?
The InChIKey is MDBKATSYSVMKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-6-8(9(12)13-3)7(5-11)4-10(6)2/h4-5H,1-3H3.
What are the key properties of methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate?
methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate has a molecular weight of 181.19 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-formyl-1,2-dimethylpyrrole-3-carboxylate is sourced from PubChem (CID 82408639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).