About dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate
dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate (PubChem CID 164905081) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate.
Analyze dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate (CID 164905081) is dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate is COC(=O)c1c(C)n(C)c(C)c(C(=O)OC)c1=O.
What is the InChIKey of dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate?
The InChIKey is PAXMBKVWJGBJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO5/c1-6-8(11(15)17-4)10(14)9(12(16)18-5)7(2)13(6)3/h1-5H3.
What are the key properties of dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate?
dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate has a molecular weight of 253.25 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1,2,6-trimethyl-4-oxopyridine-3,5-dicarboxylate is sourced from PubChem (CID 164905081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).