C9H12N2O4 — CID 112713972
dimethyl 2-amino-1-methylpyrrole-3,4-dicarboxylate (PubChem CID 112713972) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is dimethyl 2-amino-1-methylpyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 2-amino-1-methylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 112713972 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | dimethyl 2-amino-1-methylpyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1cn(C)c(N)c1C(=O)OC |
| InChI | InChI=1S/C9H12N2O4/c1-11-4-5(8(12)14-2)6(7(11)10)9(13)15-3/h4H,10H2,1-3H3 |
| InChIKey | JUFSTCORXBVSTF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |