C10H13N3O5 — CID 11107917
dimethyl 1-(carbamoylamino)-2-methylpyrrole-3,4-dicarboxylate (PubChem CID 11107917) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is dimethyl 1-(carbamoylamino)-2-methylpyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-(carbamoylamino)-2-methylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11107917 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | dimethyl 1-(carbamoylamino)-2-methylpyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1cn(NC(N)=O)c(C)c1C(=O)OC |
| InChI | InChI=1S/C10H13N3O5/c1-5-7(9(15)18-3)6(8(14)17-2)4-13(5)12-10(11)16/h4H,1-3H3,(H3,11,12,16) |
| InChIKey | RJQVKYHFPLGPRK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |