C15H21N3O7 — CID 23245183
3-O-ethyl 4-O-methyl 1-(carbamoylamino)-2-(2-ethoxy-2-oxoethyl)-5-methylpyrrole-3,4-dicarboxylate (PubChem CID 23245183) has the molecular formula C15H21N3O7 and a molecular weight of 355.35 g/mol. Its IUPAC name is 3-O-ethyl 4-O-methyl 1-(carbamoylamino)-2-(2-ethoxy-2-oxoethyl)-5-methylpyrrole-3,4-dicarboxylate.
| Compound Name | 3-O-ethyl 4-O-methyl 1-(carbamoylamino)-2-(2-ethoxy-2-oxoethyl)-5-methylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 23245183 |
| Molecular Formula | C15H21N3O7 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-O-ethyl 4-O-methyl 1-(carbamoylamino)-2-(2-ethoxy-2-oxoethyl)-5-methylpyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)Cc1c(C(=O)OCC)c(C(=O)OC)c(C)n1NC(N)=O |
| InChI | InChI=1S/C15H21N3O7/c1-5-24-10(19)7-9-12(14(21)25-6-2)11(13(20)23-4)8(3)18(9)17-15(16)22/h5-7H2,1-4H3,(H3,16,17,22) |
| InChIKey | RPHXFLOVCGPZDD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|