C35H36O5 — CID 59575412
methyl 4-[4-[2,6-dimethyl-4-[2-(3,4,5-trimethylphenyl)propan-2-yl]phenoxy]carbonylphenoxy]benzoate (PubChem CID 59575412) has the molecular formula C35H36O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is methyl 4-[4-[2,6-dimethyl-4-[2-(3,4,5-trimethylphenyl)propan-2-yl]phenoxy]carbonylphenoxy]benzoate.
| Compound Name | methyl 4-[4-[2,6-dimethyl-4-[2-(3,4,5-trimethylphenyl)propan-2-yl]phenoxy]carbonylphenoxy]benzoate |
|---|---|
| PubChem CID | 59575412 |
| Molecular Formula | C35H36O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | methyl 4-[4-[2,6-dimethyl-4-[2-(3,4,5-trimethylphenyl)propan-2-yl]phenoxy]carbonylphenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(C(=O)Oc3c(C)cc(C(C)(C)c4cc(C)c(C)c(C)c4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C35H36O5/c1-21-17-28(18-22(2)25(21)5)35(6,7)29-19-23(3)32(24(4)20-29)40-34(37)27-11-15-31(16-12-27)39-30-13-9-26(10-14-30)33(36)38-8/h9-20H,1-8H3 |
| InChIKey | LRMIWPMYZPBQPU-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|