C17H17BrO5S — CID 175194519
methyl 4-(3-bromo-2,6-dimethyl-4-methylsulfonylphenoxy)benzoate (PubChem CID 175194519) has the molecular formula C17H17BrO5S and a molecular weight of 413.29 g/mol. Its IUPAC name is methyl 4-(3-bromo-2,6-dimethyl-4-methylsulfonylphenoxy)benzoate.
| Compound Name | methyl 4-(3-bromo-2,6-dimethyl-4-methylsulfonylphenoxy)benzoate |
|---|---|
| PubChem CID | 175194519 |
| Molecular Formula | C17H17BrO5S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | methyl 4-(3-bromo-2,6-dimethyl-4-methylsulfonylphenoxy)benzoate |
| SMILES | COC(=O)c1ccc(Oc2c(C)cc(S(C)(=O)=O)c(Br)c2C)cc1 |
| InChI | InChI=1S/C17H17BrO5S/c1-10-9-14(24(4,20)21)15(18)11(2)16(10)23-13-7-5-12(6-8-13)17(19)22-3/h5-9H,1-4H3 |
| InChIKey | UCZXJDLIQJOREE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |