C16H18O3S — CID 123756567
1,5-dimethyl-2-(4-methylphenoxy)-3-methylsulfonylbenzene (PubChem CID 123756567) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 1,5-dimethyl-2-(4-methylphenoxy)-3-methylsulfonylbenzene.
| Compound Name | 1,5-dimethyl-2-(4-methylphenoxy)-3-methylsulfonylbenzene |
|---|---|
| PubChem CID | 123756567 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1,5-dimethyl-2-(4-methylphenoxy)-3-methylsulfonylbenzene |
| SMILES | Cc1ccc(Oc2c(C)cc(C)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-11-5-7-14(8-6-11)19-16-13(3)9-12(2)10-15(16)20(4,17)18/h5-10H,1-4H3 |
| InChIKey | FKJCNFJWZJGIAJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |