C37H46O2S2 — CID 143168284
ethene;[2-methoxy-3-methyl-5-[2-[3-methyl-4-(4-methylphenoxy)-5-(sulfanylmethyl)phenyl]propan-2-yl]phenyl]methanethiol;1,4-xylene (PubChem CID 143168284) has the molecular formula C37H46O2S2 and a molecular weight of 586.91 g/mol. Its IUPAC name is ethene;[2-methoxy-3-methyl-5-[2-[3-methyl-4-(4-methylphenoxy)-5-(sulfanylmethyl)phenyl]propan-2-yl]phenyl]methanethiol;1,4-xylene.
| Compound Name | ethene;[2-methoxy-3-methyl-5-[2-[3-methyl-4-(4-methylphenoxy)-5-(sulfanylmethyl)phenyl]propan-2-yl]phenyl]methanethiol;1,4-xylene |
|---|---|
| PubChem CID | 143168284 |
| Molecular Formula | C37H46O2S2 |
| Molecular Weight | 586.91 g/mol |
| Exact Mass | 586.29 |
| IUPAC Name | ethene;[2-methoxy-3-methyl-5-[2-[3-methyl-4-(4-methylphenoxy)-5-(sulfanylmethyl)phenyl]propan-2-yl]phenyl]methanethiol;1,4-xylene |
| SMILES | C=C.COc1c(C)cc(C(C)(C)c2cc(C)c(Oc3ccc(C)cc3)c(CS)c2)cc1CS.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C27H32O2S2.C8H10.C2H4/c1-17-7-9-24(10-8-17)29-26-19(3)12-23(14-21(26)16-31)27(4,5)22-11-18(2)25(28-6)20(13-22)15-30;1-7-3-5-8(2)6-4-7;1-2/h7-14,30-31H,15-16H2,1-6H3;3-6H,1-2H3;1-2H2 |
| InChIKey | BVWSBMIFGHZSES-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.91 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|