C28H34O — CID 163745611
1-methyl-4-[4-[2-[4-(3-methylpentan-3-yl)phenyl]propan-2-yl]phenoxy]benzene (PubChem CID 163745611) has the molecular formula C28H34O and a molecular weight of 386.58 g/mol. Its IUPAC name is 1-methyl-4-[4-[2-[4-(3-methylpentan-3-yl)phenyl]propan-2-yl]phenoxy]benzene.
| Compound Name | 1-methyl-4-[4-[2-[4-(3-methylpentan-3-yl)phenyl]propan-2-yl]phenoxy]benzene |
|---|---|
| PubChem CID | 163745611 |
| Molecular Formula | C28H34O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-methyl-4-[4-[2-[4-(3-methylpentan-3-yl)phenyl]propan-2-yl]phenoxy]benzene |
| SMILES | CCC(C)(CC)c1ccc(C(C)(C)c2ccc(Oc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H34O/c1-7-28(6,8-2)24-13-11-22(12-14-24)27(4,5)23-15-19-26(20-16-23)29-25-17-9-21(3)10-18-25/h9-20H,7-8H2,1-6H3 |
| InChIKey | LLPFKLCLGNLZOH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |