C45H42N4O4 — CID 69301255
4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline (PubChem CID 69301255) has the molecular formula C45H42N4O4 and a molecular weight of 702.86 g/mol. Its IUPAC name is 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline.
| Compound Name | 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 69301255 |
| Molecular Formula | C45H42N4O4 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline |
| SMILES | CC(C)(c1ccc(Oc2ccc(N)cc2)cc1)c1ccc(Oc2ccc(N)cc2)cc1.Nc1ccc(Oc2ccc(Oc3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O2.C18H16N2O2/c1-27(2,19-3-11-23(12-4-19)30-25-15-7-21(28)8-16-25)20-5-13-24(14-6-20)31-26-17-9-22(29)10-18-26;19-13-1-5-15(6-2-13)21-17-9-11-18(12-10-17)22-16-7-3-14(20)4-8-16/h3-18H,28-29H2,1-2H3;1-12H,19-20H2 |
| InChIKey | NFKQMKSQDUPLLA-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|