C40H36N2O4 — CID 59048775
4-[4-[2-[4-[4-[(4-phenoxyphenoxy)methylamino]phenoxy]phenyl]propan-2-yl]phenoxy]aniline (PubChem CID 59048775) has the molecular formula C40H36N2O4 and a molecular weight of 608.74 g/mol. Its IUPAC name is 4-[4-[2-[4-[4-[(4-phenoxyphenoxy)methylamino]phenoxy]phenyl]propan-2-yl]phenoxy]aniline.
| Compound Name | 4-[4-[2-[4-[4-[(4-phenoxyphenoxy)methylamino]phenoxy]phenyl]propan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 59048775 |
| Molecular Formula | C40H36N2O4 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 4-[4-[2-[4-[4-[(4-phenoxyphenoxy)methylamino]phenoxy]phenyl]propan-2-yl]phenoxy]aniline |
| SMILES | CC(C)(c1ccc(Oc2ccc(N)cc2)cc1)c1ccc(Oc2ccc(NCOc3ccc(Oc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H36N2O4/c1-40(2,29-8-16-35(17-9-29)45-37-20-12-31(41)13-21-37)30-10-18-36(19-11-30)46-38-22-14-32(15-23-38)42-28-43-33-24-26-39(27-25-33)44-34-6-4-3-5-7-34/h3-27,42H,28,41H2,1-2H3 |
| InChIKey | DCUZHUHRZQCAPD-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|