C55H51F6N5O4 — CID 157445194
4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylaniline (PubChem CID 157445194) has the molecular formula C55H51F6N5O4 and a molecular weight of 960.03 g/mol. Its IUPAC name is 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylaniline.
| Compound Name | 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylaniline |
|---|---|
| PubChem CID | 157445194 |
| Molecular Formula | C55H51F6N5O4 |
| Molecular Weight | 960.03 g/mol |
| Exact Mass | 959.38 |
| IUPAC Name | 4-[4-(4-aminophenoxy)phenoxy]aniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline;5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylaniline |
| SMILES | CC(C)(c1ccc(Oc2ccc(N)cc2)cc1)c1ccc(Oc2ccc(N)cc2)cc1.Cc1ccc(C(C(F)(F)F)C(F)(F)F)cc1N.Nc1ccc(Oc2ccc(Oc3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O2.C18H16N2O2.C10H9F6N/c1-27(2,19-3-11-23(12-4-19)30-25-15-7-21(28)8-16-25)20-5-13-24(14-6-20)31-26-17-9-22(29)10-18-26;19-13-1-5-15(6-2-13)21-17-9-11-18(12-10-17)22-16-7-3-14(20)4-8-16;1-5-2-3-6(4-7(5)17)8(9(11,12)13)10(14,15)16/h3-18H,28-29H2,1-2H3;1-12H,19-20H2;2-4,8H,17H2,1H3 |
| InChIKey | BSDFYAUHZXFVNE-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.03 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|