C16H10F9NO — CID 151186344
3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]-4-(trifluoromethyl)aniline (PubChem CID 151186344) has the molecular formula C16H10F9NO and a molecular weight of 403.24 g/mol. Its IUPAC name is 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]-4-(trifluoromethyl)aniline.
| Compound Name | 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 151186344 |
| Molecular Formula | C16H10F9NO |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 3-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]-4-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C(F)(F)F)c(Oc2ccc(C(C(F)(F)F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H10F9NO/c17-14(18,19)11-6-3-9(26)7-12(11)27-10-4-1-8(2-5-10)13(15(20,21)22)16(23,24)25/h1-7,13H,26H2 |
| InChIKey | NFJPECZCLAFROM-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|