C51H44N4O4 — CID 172849484
4-[4-[1,1,1-tris[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline (PubChem CID 172849484) has the molecular formula C51H44N4O4 and a molecular weight of 776.94 g/mol. Its IUPAC name is 4-[4-[1,1,1-tris[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline.
| Compound Name | 4-[4-[1,1,1-tris[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 172849484 |
| Molecular Formula | C51H44N4O4 |
| Molecular Weight | 776.94 g/mol |
| Exact Mass | 776.34 |
| IUPAC Name | 4-[4-[1,1,1-tris[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline |
| SMILES | CC(c1ccc(Oc2ccc(N)cc2)cc1)C(c1ccc(Oc2ccc(N)cc2)cc1)(c1ccc(Oc2ccc(N)cc2)cc1)c1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C51H44N4O4/c1-34(35-2-18-43(19-3-35)56-47-26-10-39(52)11-27-47)51(36-4-20-44(21-5-36)57-48-28-12-40(53)13-29-48,37-6-22-45(23-7-37)58-49-30-14-41(54)15-31-49)38-8-24-46(25-9-38)59-50-32-16-42(55)17-33-50/h2-34H,52-55H2,1H3 |
| InChIKey | XWJCILWVGRMQEV-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.94 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|