C41H36F6N4O2 — CID 158953652
4-(4-amino-2-methylphenyl)-3-methylaniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline (PubChem CID 158953652) has the molecular formula C41H36F6N4O2 and a molecular weight of 730.75 g/mol. Its IUPAC name is 4-(4-amino-2-methylphenyl)-3-methylaniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline.
| Compound Name | 4-(4-amino-2-methylphenyl)-3-methylaniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline |
|---|---|
| PubChem CID | 158953652 |
| Molecular Formula | C41H36F6N4O2 |
| Molecular Weight | 730.75 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | 4-(4-amino-2-methylphenyl)-3-methylaniline;4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]aniline |
| SMILES | Cc1cc(N)ccc1-c1ccc(N)cc1C.Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H20F6N2O2.C14H16N2/c28-26(29,30)25(27(31,32)33,17-1-9-21(10-2-17)36-23-13-5-19(34)6-14-23)18-3-11-22(12-4-18)37-24-15-7-20(35)8-16-24;1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2/h1-16H,34-35H2;3-8H,15-16H2,1-2H3 |
| InChIKey | JLSVJDWREIKBOX-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.75 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|