C27H19F7N2O2 — CID 57107456
4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-fluoroaniline (PubChem CID 57107456) has the molecular formula C27H19F7N2O2 and a molecular weight of 536.45 g/mol. Its IUPAC name is 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-fluoroaniline.
| Compound Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-fluoroaniline |
|---|---|
| PubChem CID | 57107456 |
| Molecular Formula | C27H19F7N2O2 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 4-[4-[2-[4-(4-aminophenoxy)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-fluoroaniline |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4F)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H19F7N2O2/c28-23-15-19(36)7-14-24(23)38-22-10-3-17(4-11-22)25(26(29,30)31,27(32,33)34)16-1-8-20(9-2-16)37-21-12-5-18(35)6-13-21/h1-15H,35-36H2 |
| InChIKey | RGPQKLMLVISNHB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|