C31H22F12N2O2 — CID 88508448
4-[4-[2-[4-[4-amino-2-(2,2,2-trifluoroethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(2,2,2-trifluoroethyl)aniline (PubChem CID 88508448) has the molecular formula C31H22F12N2O2 and a molecular weight of 682.50 g/mol. Its IUPAC name is 4-[4-[2-[4-[4-amino-2-(2,2,2-trifluoroethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[4-[2-[4-[4-amino-2-(2,2,2-trifluoroethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 88508448 |
| Molecular Formula | C31H22F12N2O2 |
| Molecular Weight | 682.50 g/mol |
| Exact Mass | 682.15 |
| IUPAC Name | 4-[4-[2-[4-[4-amino-2-(2,2,2-trifluoroethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(2,2,2-trifluoroethyl)aniline |
| SMILES | Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(N)cc4CC(F)(F)F)cc3)(C(F)(F)F)C(F)(F)F)cc2)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C31H22F12N2O2/c32-27(33,34)15-17-13-21(44)5-11-25(17)46-23-7-1-19(2-8-23)29(30(38,39)40,31(41,42)43)20-3-9-24(10-4-20)47-26-12-6-22(45)14-18(26)16-28(35,36)37/h1-14H,15-16,44-45H2 |
| InChIKey | GELFIISEYBKMSF-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.50 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|