C38H40N2O2 — CID 139685602
3-[4-[2-[3-[2-[4-(5-amino-2-methylphenoxy)phenyl]propan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methylaniline (PubChem CID 139685602) has the molecular formula C38H40N2O2 and a molecular weight of 556.75 g/mol. Its IUPAC name is 3-[4-[2-[3-[2-[4-(5-amino-2-methylphenoxy)phenyl]propan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methylaniline.
| Compound Name | 3-[4-[2-[3-[2-[4-(5-amino-2-methylphenoxy)phenyl]propan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methylaniline |
|---|---|
| PubChem CID | 139685602 |
| Molecular Formula | C38H40N2O2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 3-[4-[2-[3-[2-[4-(5-amino-2-methylphenoxy)phenyl]propan-2-yl]phenyl]propan-2-yl]phenoxy]-4-methylaniline |
| SMILES | Cc1ccc(N)cc1Oc1ccc(C(C)(C)c2cccc(C(C)(C)c3ccc(Oc4cc(N)ccc4C)cc3)c2)cc1 |
| InChI | InChI=1S/C38H40N2O2/c1-25-10-16-31(39)23-35(25)41-33-18-12-27(13-19-33)37(3,4)29-8-7-9-30(22-29)38(5,6)28-14-20-34(21-15-28)42-36-24-32(40)17-11-26(36)2/h7-24H,39-40H2,1-6H3 |
| InChIKey | CEWXCLIEMWJIOJ-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|