C28H36N2O8 — CID 156711601
2-(diformylamino)-N-methyl-5-oxopentanamide;4-[5-(3,4-dimethylphenoxy)pentoxy]benzoic acid (PubChem CID 156711601) has the molecular formula C28H36N2O8 and a molecular weight of 528.60 g/mol. Its IUPAC name is 2-(diformylamino)-N-methyl-5-oxopentanamide;4-[5-(3,4-dimethylphenoxy)pentoxy]benzoic acid.
| Compound Name | 2-(diformylamino)-N-methyl-5-oxopentanamide;4-[5-(3,4-dimethylphenoxy)pentoxy]benzoic acid |
|---|---|
| PubChem CID | 156711601 |
| Molecular Formula | C28H36N2O8 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 2-(diformylamino)-N-methyl-5-oxopentanamide;4-[5-(3,4-dimethylphenoxy)pentoxy]benzoic acid |
| SMILES | CNC(=O)C(CCC=O)N(C=O)C=O.Cc1ccc(OCCCCCOc2ccc(C(=O)O)cc2)cc1C |
| InChI | InChI=1S/C20H24O4.C8H12N2O4/c1-15-6-9-19(14-16(15)2)24-13-5-3-4-12-23-18-10-7-17(8-11-18)20(21)22;1-9-8(14)7(3-2-4-11)10(5-12)6-13/h6-11,14H,3-5,12-13H2,1-2H3,(H,21,22);4-7H,2-3H2,1H3,(H,9,14) |
| InChIKey | XPMXTGJJBKVYAD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|