C26H38N4O8 — CID 167470035
tert-butyl 3-[2-[[2-[3-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]-4-methylanilino]acetyl]amino]ethoxy]propanoate (PubChem CID 167470035) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is tert-butyl 3-[2-[[2-[3-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]-4-methylanilino]acetyl]amino]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[[2-[3-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]-4-methylanilino]acetyl]amino]ethoxy]propanoate |
|---|---|
| PubChem CID | 167470035 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | tert-butyl 3-[2-[[2-[3-[formyl-[1-(methylamino)-1,5-dioxopentan-2-yl]carbamoyl]-4-methylanilino]acetyl]amino]ethoxy]propanoate |
| SMILES | CNC(=O)C(CCC=O)N(C=O)C(=O)c1cc(NCC(=O)NCCOCCC(=O)OC(C)(C)C)ccc1C |
| InChI | InChI=1S/C26H38N4O8/c1-18-8-9-19(15-20(18)25(36)30(17-32)21(7-6-12-31)24(35)27-5)29-16-22(33)28-11-14-37-13-10-23(34)38-26(2,3)4/h8-9,12,15,17,21,29H,6-7,10-11,13-14,16H2,1-5H3,(H,27,35)(H,28,33) |
| InChIKey | OKOZPTFYFSEHBY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|