C25H40N4O6 — CID 153393791
2-[formyl-[[2-methyl-6-[3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethylamino]-3-oxopropyl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide (PubChem CID 153393791) has the molecular formula C25H40N4O6 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-[formyl-[[2-methyl-6-[3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethylamino]-3-oxopropyl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide.
| Compound Name | 2-[formyl-[[2-methyl-6-[3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethylamino]-3-oxopropyl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 153393791 |
| Molecular Formula | C25H40N4O6 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 2-[formyl-[[2-methyl-6-[3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethylamino]-3-oxopropyl]phenyl]methyl]amino]-N-methyl-5-oxopentanamide |
| SMILES | CNCCOCCOCCNC(=O)CCc1cccc(C)c1CN(C=O)C(CCC=O)C(=O)NC |
| InChI | InChI=1S/C25H40N4O6/c1-20-6-4-7-21(9-10-24(32)28-12-15-35-17-16-34-14-11-26-2)22(20)18-29(19-31)23(8-5-13-30)25(33)27-3/h4,6-7,13,19,23,26H,5,8-12,14-18H2,1-3H3,(H,27,33)(H,28,32) |
| InChIKey | MRLCPEPXAFEBQZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|