C26H44N4O6 — CID 166714864
N-[3-formyl-2-[[methyl(5-oxopentan-2-yl)amino]methyl]phenyl]-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]propanamide (PubChem CID 166714864) has the molecular formula C26H44N4O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[3-formyl-2-[[methyl(5-oxopentan-2-yl)amino]methyl]phenyl]-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]propanamide.
| Compound Name | N-[3-formyl-2-[[methyl(5-oxopentan-2-yl)amino]methyl]phenyl]-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]propanamide |
|---|---|
| PubChem CID | 166714864 |
| Molecular Formula | C26H44N4O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | N-[3-formyl-2-[[methyl(5-oxopentan-2-yl)amino]methyl]phenyl]-3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]propanamide |
| SMILES | CNCCOCCOCCOCCNCCC(=O)Nc1cccc(C=O)c1CN(C)C(C)CCC=O |
| InChI | InChI=1S/C26H44N4O6/c1-22(6-5-13-31)30(3)20-24-23(21-32)7-4-8-25(24)29-26(33)9-10-28-12-15-35-17-19-36-18-16-34-14-11-27-2/h4,7-8,13,21-22,27-28H,5-6,9-12,14-20H2,1-3H3,(H,29,33) |
| InChIKey | ZPDDDABBRCQPGV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|