C20H33N5O4 — CID 156882816
3-[3-(4-aminobutoxy)propylamino]-N-[2-[[formamido(methyl)amino]methyl]-3-formylphenyl]propanamide (PubChem CID 156882816) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[3-(4-aminobutoxy)propylamino]-N-[2-[[formamido(methyl)amino]methyl]-3-formylphenyl]propanamide.
| Compound Name | 3-[3-(4-aminobutoxy)propylamino]-N-[2-[[formamido(methyl)amino]methyl]-3-formylphenyl]propanamide |
|---|---|
| PubChem CID | 156882816 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 3-[3-(4-aminobutoxy)propylamino]-N-[2-[[formamido(methyl)amino]methyl]-3-formylphenyl]propanamide |
| SMILES | CN(Cc1c(C=O)cccc1NC(=O)CCNCCCOCCCCN)NC=O |
| InChI | InChI=1S/C20H33N5O4/c1-25(23-16-27)14-18-17(15-26)6-4-7-19(18)24-20(28)8-11-22-10-5-13-29-12-3-2-9-21/h4,6-7,15-16,22H,2-3,5,8-14,21H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | ZPWDQALQBAYAJJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|