C19H27N3O4 — CID 153393794
N-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]propanamide;ethane (PubChem CID 153393794) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]propanamide;ethane.
| Compound Name | N-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]propanamide;ethane |
|---|---|
| PubChem CID | 153393794 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[2-[[(2,6-dioxopiperidin-3-yl)-methylamino]methyl]-3-formylphenyl]propanamide;ethane |
| SMILES | CC.CCC(=O)Nc1cccc(C=O)c1CN(C)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C17H21N3O4.C2H6/c1-3-15(22)18-13-6-4-5-11(10-21)12(13)9-20(2)14-7-8-16(23)19-17(14)24;1-2/h4-6,10,14H,3,7-9H2,1-2H3,(H,18,22)(H,19,23,24);1-2H3 |
| InChIKey | MGKKPQNLOONHSO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|