C19H24N2O5 — CID 170109243
N-(2,6-dioxopiperidin-3-yl)-2-formyl-6-(5-hydroxypentyl)-N-methylbenzamide (PubChem CID 170109243) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-6-(5-hydroxypentyl)-N-methylbenzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-6-(5-hydroxypentyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 170109243 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-6-(5-hydroxypentyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1c(C=O)cccc1CCCCCO)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H24N2O5/c1-21(15-9-10-16(24)20-18(15)25)19(26)17-13(6-3-2-4-11-22)7-5-8-14(17)12-23/h5,7-8,12,15,22H,2-4,6,9-11H2,1H3,(H,20,24,25) |
| InChIKey | WXQXLKBBJYZFQE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|