C20H27N3O6 — CID 154690124
N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-(5-oxopentylamino)benzamide;methanol (PubChem CID 154690124) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-(5-oxopentylamino)benzamide;methanol.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-(5-oxopentylamino)benzamide;methanol |
|---|---|
| PubChem CID | 154690124 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-(5-oxopentylamino)benzamide;methanol |
| SMILES | CN(C(=O)c1cccc(NCCCCC=O)c1C=O)C1CCC(=O)NC1=O.CO |
| InChI | InChI=1S/C19H23N3O5.CH4O/c1-22(16-8-9-17(25)21-18(16)26)19(27)13-6-5-7-15(14(13)12-24)20-10-3-2-4-11-23;1-2/h5-7,11-12,16,20H,2-4,8-10H2,1H3,(H,21,25,26);2H,1H3 |
| InChIKey | OMLPIOJNJUWQCI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|