C22H26N4O5 — CID 170001226
N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4E)-2-ethenyl-6-hydroxy-5-methylhexa-2,4-dienyl]amino]-2-formylbenzohydrazide (PubChem CID 170001226) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4E)-2-ethenyl-6-hydroxy-5-methylhexa-2,4-dienyl]amino]-2-formylbenzohydrazide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4E)-2-ethenyl-6-hydroxy-5-methylhexa-2,4-dienyl]amino]-2-formylbenzohydrazide |
|---|---|
| PubChem CID | 170001226 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-[[(2E,4E)-2-ethenyl-6-hydroxy-5-methylhexa-2,4-dienyl]amino]-2-formylbenzohydrazide |
| SMILES | C=C/C(=C\C=C(/C)CO)CNc1cccc(C(=O)N(N)C2CCC(=O)NC2=O)c1C=O |
| InChI | InChI=1S/C22H26N4O5/c1-3-15(8-7-14(2)12-27)11-24-18-6-4-5-16(17(18)13-28)22(31)26(23)19-9-10-20(29)25-21(19)30/h3-8,13,19,24,27H,1,9-12,23H2,2H3,(H,25,29,30)/b14-7+,15-8+ |
| InChIKey | PJPAHHMWVGNMMR-IROCBMIISA-N |
| XLogP | 1.08 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|