C30H40N4O4 — CID 170003163
3-[[(2E,4E)-6-(azocan-1-yl)-2-ethenyl-5-methylhexa-2,4-dienyl]amino]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide (PubChem CID 170003163) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 3-[[(2E,4E)-6-(azocan-1-yl)-2-ethenyl-5-methylhexa-2,4-dienyl]amino]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide.
| Compound Name | 3-[[(2E,4E)-6-(azocan-1-yl)-2-ethenyl-5-methylhexa-2,4-dienyl]amino]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 170003163 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 3-[[(2E,4E)-6-(azocan-1-yl)-2-ethenyl-5-methylhexa-2,4-dienyl]amino]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
| SMILES | C=C/C(=C\C=C(/C)CN1CCCCCCC1)CNc1cccc(C(=O)N(C=O)C2CCC(=O)NC2=O)c1C |
| InChI | InChI=1S/C30H40N4O4/c1-4-24(14-13-22(2)20-33-17-8-6-5-7-9-18-33)19-31-26-12-10-11-25(23(26)3)30(38)34(21-35)27-15-16-28(36)32-29(27)37/h4,10-14,21,27,31H,1,5-9,15-20H2,2-3H3,(H,32,36,37)/b22-13+,24-14+ |
| InChIKey | HQIAPBKASDVSHL-ANGVJMTBSA-N |
| XLogP | 4.14 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|