C20H26N4O6 — CID 145229590
3-[2-(4-aminobutylamino)-2-oxoethoxy]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide (PubChem CID 145229590) has the molecular formula C20H26N4O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-[2-(4-aminobutylamino)-2-oxoethoxy]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide.
| Compound Name | 3-[2-(4-aminobutylamino)-2-oxoethoxy]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 145229590 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[2-(4-aminobutylamino)-2-oxoethoxy]-N-(2,6-dioxopiperidin-3-yl)-N-formyl-2-methylbenzamide |
| SMILES | Cc1c(OCC(=O)NCCCCN)cccc1C(=O)N(C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C20H26N4O6/c1-13-14(20(29)24(12-25)15-7-8-17(26)23-19(15)28)5-4-6-16(13)30-11-18(27)22-10-3-2-9-21/h4-6,12,15H,2-3,7-11,21H2,1H3,(H,22,27)(H,23,26,28) |
| InChIKey | LHWDMWSTKUVTTG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|