C21H31N3O5 — CID 145229559
2-(4-aminobutoxy)-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methylbenzamide;propane (PubChem CID 145229559) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-(4-aminobutoxy)-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methylbenzamide;propane.
| Compound Name | 2-(4-aminobutoxy)-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methylbenzamide;propane |
|---|---|
| PubChem CID | 145229559 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-(4-aminobutoxy)-N-(2,6-dioxopiperidin-3-yl)-6-formyl-N-methylbenzamide;propane |
| SMILES | CCC.CN(C(=O)c1c(C=O)cccc1OCCCCN)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H23N3O5.C3H8/c1-21(13-7-8-15(23)20-17(13)24)18(25)16-12(11-22)5-4-6-14(16)26-10-3-2-9-19;1-3-2/h4-6,11,13H,2-3,7-10,19H2,1H3,(H,20,23,24);3H2,1-2H3 |
| InChIKey | BDBAMYJBWWLVFP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|